Dicyclohexyldichlorotin

• Catalog Number: ACM3342696
• Product Name: Dicyclohexyldichlorotin
• CAS: 3342-69-6
• Category: Organic Tin
• Synonyms: DICYCLOHEXYLDICHLOROTIN;DICYCLOHEXYLDICHLOROTIN 95%;Dicyclohexyldichlorostannane;Dicyclohexyltin(IV) dichloride;dichloro(dicyclohexyl)stannane
• Molecular Weight: 355.92
• Molecular Formula: C₁₂H₂₂Cl₂Sn

Custom Q&A

What is the molecular formula of Dicyclohexyldichlorotin?

The molecular formula is C12H22Cl2Sn.

What is the molecular weight of Dicyclohexyldichlorotin?

The molecular weight is 355.9 g/mol.

What is the IUPAC name of Dicyclohexyldichlorotin?

The IUPAC name is dichloro(dicyclohexyl)stannane.

What is the InChIKey of Dicyclohexyldichlorotin?

The InChIKey is NXLNBJXGFFFGIT-UHFFFAOYSA-L.

What is the Canonical SMILES of Dicyclohexyldichlorotin?

The Canonical SMILES is C1CCC(CC1)[Sn](C2CCCCC2)(Cl)Cl.

What is the CAS number of Dicyclohexyldichlorotin?

The CAS number is 3342-69-6.

How many hydrogen bond donor counts does Dicyclohexyldichlorotin have?

It has 0 hydrogen bond donor counts.

How many rotatable bond counts does Dicyclohexyldichlorotin have?

It has 2 rotatable bond counts.

What is the exact mass of Dicyclohexyldichlorotin?

The exact mass is 356.012059 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.