What is the molecular formula of diclofop?
The molecular formula of diclofop is C15H12Cl2O4.
What is the molecular weight of diclofop?
The molecular weight of diclofop is 327.2 g/mol.
What are some synonyms for diclofop?
Some synonyms for diclofop include Diclofop acid, (+/-)-Diclofop, and 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid.
What is the IUPAC name of diclofop?
The IUPAC name of diclofop is 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoic acid.
What is the Canonical SMILES representation of diclofop?
The Canonical SMILES representation of diclofop is CC(C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl.
What is the InChIKey of diclofop?
The InChIKey of diclofop is OOLBCHYXZDXLDS-UHFFFAOYSA-N.
What is the CAS number of diclofop?
The CAS number of diclofop is 40843-25-2.
What is the XLogP3 value of diclofop?
The XLogP3 value of diclofop is 5.
How many hydrogen bond acceptor counts does diclofop have?
Diclofop has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of diclofop?
The topological polar surface area of diclofop is 55.8 Å2.