The molecular formula of the compound is C11H16Cl2OSi.
What are the synonyms for the compound?
The synonyms for the compound include 134438-26-9, 3-(4-METHOXYPHENYL)PROPYLMETHYLDICHLOROSILANE, dichloro(3-(4-methoxyphenyl)propyl)(methyl)silane, and more.
What is the molecular weight of the compound?
The molecular weight of the compound is 263.23 g/mol.
How was the molecular weight computed?
The molecular weight was computed by PubChem 2.1.
What is the IUPAC name of the compound?
The IUPAC name of the compound is dichloro-[3-(4-methoxyphenyl)propyl]-methylsilane.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H16Cl2OSi/c1-14-11-7-5-10(6-8-11)4-3-9-15(2,12)13/h5-8H,3-4,9H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is HDYGTUBIAPFWFO-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=CC=C(C=C1)CCC[Si](C)(Cl)Cl.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many rotatable bond counts does the compound have?
The compound has 5 rotatable bond counts.
※ Please kindly note that our products are for research use only.