What is the molecular formula of Dichloromaleic anhydride?
The molecular formula of Dichloromaleic anhydride is C4Cl2O3.
What is the molecular weight of Dichloromaleic anhydride?
The molecular weight of Dichloromaleic anhydride is 166.94 g/mol.
What is the IUPAC name of Dichloromaleic anhydride?
The IUPAC name of Dichloromaleic anhydride is 3,4-dichlorofuran-2,5-dione.
What is the InChI of Dichloromaleic anhydride?
The InChI of Dichloromaleic anhydride is InChI=1S/C4Cl2O3/c5-1-2(6)4(8)9-3(1)7.
What is the InChIKey of Dichloromaleic anhydride?
The InChIKey of Dichloromaleic anhydride is AGULWIQIYWWFBJ-UHFFFAOYSA-N.
What is the canonical SMILES of Dichloromaleic anhydride?
The canonical SMILES of Dichloromaleic anhydride is C1(=C(C(=O)OC1=O)Cl)Cl.
What is the CAS number of Dichloromaleic anhydride?
The CAS number of Dichloromaleic anhydride is 1122-17-4.
What is the EC number of Dichloromaleic anhydride?
The EC number of Dichloromaleic anhydride is 214-343-0.
How many hydrogen bond acceptor counts does Dichloromaleic anhydride have?
Dichloromaleic anhydride has 3 hydrogen bond acceptor counts.