What is the molecular formula of Dichloroketene?
The molecular formula of Dichloroketene is C2Cl2O.
What is the molecular weight of Dichloroketene?
The molecular weight of Dichloroketene is 110.92 g/mol.
When was Dichloroketene created and modified?
Dichloroketene was created on 2005-03-27 and last modified on 2023-12-30.
What is the InChI of Dichloroketene?
The InChI of Dichloroketene is InChI=1S/C2Cl2O/c3-2(4)1-5.
What is the InChIKey of Dichloroketene?
The InChIKey of Dichloroketene is TVWWMKZMZALOFP-UHFFFAOYSA-N.
What is the CAS number of Dichloroketene?
The CAS number of Dichloroketene is 4591-28-0.
What is the EC number of Dichloroketene?
The EC number of Dichloroketene is 224-980-6.
What is the molecular weight of Dichloroketene according to PubChem?
The molecular weight of Dichloroketene according to PubChem is 110.92 g/mol.
How many hydrogen bond donor counts does Dichloroketene have?
Dichloroketene has 0 hydrogen bond donor counts.
Is Dichloroketene a canonicalized compound?
No, Dichloroketene is not a canonicalized compound according to PubChem.
Download
![(3s,6s,12As)-1,2,3,4,6,7,12,12a-octahydro-9-methoxy-6-(2-methylpropyl)-1,4-dioxopyrazino[1,2:1,6]pyrido[3,4-b]indole-3-propanoic acid 1,1-dimethylethyl ester](https://resource.alfa-chemistry.com/structure/461054-93-3.gif)
