What is the molecular formula of Dicaprylyl carbonate?
The molecular formula of Dicaprylyl carbonate is C17H34O3.
What is the molecular weight of Dicaprylyl carbonate?
The molecular weight of Dicaprylyl carbonate is 286.4 g/mol.
What is the IUPAC name of Dicaprylyl carbonate?
The IUPAC name of Dicaprylyl carbonate is dioctyl carbonate.
What is the InChI of Dicaprylyl carbonate?
The InChI of Dicaprylyl carbonate is InChI=1S/C17H34O3/c1-3-5-7-9-11-13-15-19-17(18)20-16-14-12-10-8-6-4-2/h3-16H2,1-2H3.
What is the InChIKey of Dicaprylyl carbonate?
The InChIKey of Dicaprylyl carbonate is PKPOVTYZGGYDIJ-UHFFFAOYSA-N.
What is the canonical SMILES of Dicaprylyl carbonate?
The canonical SMILES of Dicaprylyl carbonate is CCCCCCCCOC(=O)OCCCCCCCC.
What is the CAS number of Dicaprylyl carbonate?
The CAS number of Dicaprylyl carbonate is 1680-31-5.
What is the UNII of Dicaprylyl carbonate?
The UNII of Dicaprylyl carbonate is 609A3V1SUA.
What is the XLogP3-AA value of Dicaprylyl carbonate?
The XLogP3-AA value of Dicaprylyl carbonate is 7.4.
Is Dicaprylyl carbonate a canonical compound?
Yes, Dicaprylyl carbonate is a canonical compound.