What is the molecular formula of dibutyl fumarate?
The molecular formula of dibutyl fumarate is C12H20O4.
What are some synonyms for dibutyl fumarate?
Some synonyms for dibutyl fumarate are DIBUTYL FUMARATE, Butyl fumarate, Staflex DBF, and dibutyl (E)-but-2-enedioate.
What is the molecular weight of dibutyl fumarate?
The molecular weight of dibutyl fumarate is 228.28 g/mol.
When was dibutyl fumarate created and modified?
Dibutyl fumarate was created on March 27, 2005, and last modified on December 2, 2023.
What is the IUPAC name of dibutyl fumarate?
The IUPAC name of dibutyl fumarate is dibutyl (E)-but-2-enedioate.
What is the InChI of dibutyl fumarate?
The InChI of dibutyl fumarate is InChI=1S/C12H20O4/c1-3-5-9-15-11(13)7-8-12(14)16-10-6-4-2/h7-8H,3-6,9-10H2,1-2H3/b8-7+.
What is the InChIKey of dibutyl fumarate?
The InChIKey of dibutyl fumarate is JBSLOWBPDRZSMB-BQYQJAHWSA-N.
What is the canonical SMILES of dibutyl fumarate?
The canonical SMILES of dibutyl fumarate is CCCCOC(=O)C=CC(=O)OCCCC.
How many hydrogen bond donor count does dibutyl fumarate have?
Dibutyl fumarate has 0 hydrogen bond donor count.
How many rotatable bond count does dibutyl fumarate have?
Dibutyl fumarate has 10 rotatable bond count.