What is the PubChem CID of Dibutyl carbonate?
PubChem CID 68333.
What is the molecular formula of Dibutyl carbonate?
The molecular formula of Dibutyl carbonate is C9H18O3.
What are the synonyms of Dibutyl carbonate?
The synonyms of Dibutyl carbonate are Carbonic acid, dibutyl ester, n-Butyl carbonate, and Dibutylcarbonate.
What is the molecular weight of Dibutyl carbonate?
The molecular weight of Dibutyl carbonate is 174.24 g/mol.
What is the IUPAC name of Dibutyl carbonate?
The IUPAC name of Dibutyl carbonate is dibutyl carbonate.
What is the InChI of Dibutyl carbonate?
The InChI of Dibutyl carbonate is InChI=1S/C9H18O3/c1-3-5-7-11-9(10)12-8-6-4-2/h3-8H2,1-2H3.
What is the InChIKey of Dibutyl carbonate?
The InChIKey of Dibutyl carbonate is QLVWOKQMDLQXNN-UHFFFAOYSA-N.
What is the Canonical SMILES of Dibutyl carbonate?
The Canonical SMILES of Dibutyl carbonate is CCCCOC(=O)OCCCC.
What is the CAS number of Dibutyl carbonate?
The CAS number of Dibutyl carbonate is 542-52-9.
Is Dibutyl carbonate a covalently-bonded unit?
Yes, Dibutyl carbonate is a covalently-bonded unit.