What is the PubChem CID of Dibromomaleic anhydride?
PubChem CID is 70727.
What is the molecular formula of Dibromomaleic anhydride?
The molecular formula is C4Br2O3.
What are the synonyms of Dibromomaleic anhydride?
The synonyms are 3,4-dibromofuran-2,5-dione, 1122-12-9, Dibromomaleic anhydride, 2,3-Dibromomaleic anhydride, 2,5-Furandione, 3,4-dibromo-, and more.
What is the molecular weight of Dibromomaleic anhydride?
The molecular weight is 255.85 g/mol.
What is the IUPAC name of Dibromomaleic anhydride?
The IUPAC name is 3,4-dibromofuran-2,5-dione.
What is the InChI of Dibromomaleic anhydride?
The InChI is InChI=1S/C4Br2O3/c5-1-2(6)4(8)9-3(1)7.
What is the InChIKey of Dibromomaleic anhydride?
The InChIKey is GEKJEMDSKURVLI-UHFFFAOYSA-N.
What is the canonical SMILES of Dibromomaleic anhydride?
The canonical SMILES is C1(=C(C(=O)OC1=O)Br)Br.
What is the CAS number of Dibromomaleic anhydride?
The CAS number is 1122-12-9.
What is the European Community (EC) number of Dibromomaleic anhydride?
The European Community (EC) number is 663-186-8.