What is the molecular formula of Diamfenetide?
The molecular formula of Diamfenetide is C20H24N2O5.
What is the molecular weight of Diamfenetide?
The molecular weight of Diamfenetide is 372.4 g/mol.
What is the IUPAC Name of Diamfenetide?
The IUPAC Name of Diamfenetide is N-[4-[2-[2-(4-acetamidophenoxy)ethoxy]ethoxy]phenyl]acetamide.
What is the InChI of Diamfenetide?
The InChI of Diamfenetide is InChI=1S/C20H24N2O5/c1-15(23)21-17-3-7-19(8-4-17)26-13-11-25-12-14-27-20-9-5-18(6-10-20)22-16(2)24/h3-10H,11-14H2,1-2H3,(H,21,23)(H,22,24).
What is the InChIKey of Diamfenetide?
The InChIKey of Diamfenetide is JNEZCZPNQCQCFK-UHFFFAOYSA-N.
What is the Canonical SMILES of Diamfenetide?
The Canonical SMILES of Diamfenetide is CC(=O)NC1=CC=C(C=C1)OCCOCCOC2=CC=C(C=C2)NC(=O)C.
What is the CAS number of Diamfenetide?
The CAS number of Diamfenetide is 36141-82-9.
What is the European Community (EC) Number of Diamfenetide?
The European Community (EC) Number of Diamfenetide is 252-886-5.
What is the UNII of Diamfenetide?
The UNII of Diamfenetide is U4TFJ7GB6T.
What is the XLogP3-AA value of Diamfenetide?
The XLogP3-AA value of Diamfenetide is 1.8.