What is the molecular formula of Di-n-octyltin oxide?
The molecular formula of Di-n-octyltin oxide is C16H34OSn.
What is the molecular weight of Di-n-octyltin oxide?
The molecular weight of Di-n-octyltin oxide is 361.2 g/mol.
What is the IUPAC name of Di-n-octyltin oxide?
The IUPAC name of Di-n-octyltin oxide is dioctyl(oxo)tin.
What is the InChI of Di-n-octyltin oxide?
The InChI of Di-n-octyltin oxide is InChI=1S/2C8H17.O.Sn/c2*1-3-5-7-8-6-4-2;;/h2*1,3-8H2,2H3;;.
What is the InChIKey of Di-n-octyltin oxide?
The InChIKey of Di-n-octyltin oxide is LQRUPWUPINJLMU-UHFFFAOYSA-N.
What is the canonical SMILES of Di-n-octyltin oxide?
The canonical SMILES of Di-n-octyltin oxide is CCCCCCCC[Sn](=O)CCCCCCCC.
What is the CAS number of Di-n-octyltin oxide?
The CAS number of Di-n-octyltin oxide is 870-08-6.
How many hydrogen bond donor counts does Di-n-octyltin oxide have?
Di-n-octyltin oxide has 0 hydrogen bond donor counts.
How many rotatable bond counts does Di-n-octyltin oxide have?
Di-n-octyltin oxide has 14 rotatable bond counts.