What is the molecular formula of Di-N-butylethylamine?
The molecular formula of Di-N-butylethylamine is C10H23N.
What are the synonyms of Di-N-butylethylamine?
The synonyms of Di-N-butylethylamine include di-n-Butylethylamine, N-Ethyldibutylamine, n-butyl-n-ethylbutan-1-amine, Ethyl di-N-butylamine, etc.
What is the molecular weight of Di-N-butylethylamine?
The molecular weight of Di-N-butylethylamine is 157.30 g/mol.
What is the IUPAC name of Di-N-butylethylamine?
The IUPAC name of Di-N-butylethylamine is N-butyl-N-ethylbutan-1-amine.
What is the InChI of Di-N-butylethylamine?
The InChI of Di-N-butylethylamine is InChI=1S/C10H23N/c1-4-7-9-11(6-3)10-8-5-2/h4-10H2,1-3H3.
What is the InChIKey of Di-N-butylethylamine?
The InChIKey of Di-N-butylethylamine is BBDGYADAMYMJNO-UHFFFAOYSA-N.
What is the canonical SMILES of Di-N-butylethylamine?
The canonical SMILES of Di-N-butylethylamine is CCCCN(CC)CCCC.
What is the CAS number of Di-N-butylethylamine?
The CAS number of Di-N-butylethylamine is 4458-33-7.
What is the European Community (EC) number of Di-N-butylethylamine?
The European Community (EC) number of Di-N-butylethylamine is 224-711-2.
Is Di-N-butylethylamine a covalently-bonded unit?
Yes, Di-N-butylethylamine is a covalently-bonded unit.