What is the molecular formula of Di-N-butyldiphenyltin?
The molecular formula of Di-N-butyldiphenyltin is C20H28Sn.
What is the molecular weight of Di-N-butyldiphenyltin?
The molecular weight of Di-N-butyldiphenyltin is 387.1 g/mol.
What is the IUPAC name of Di-N-butyldiphenyltin?
The IUPAC name of Di-N-butyldiphenyltin is dibutyl(diphenyl)stannane.
What is the InChI of Di-N-butyldiphenyltin?
The InChI of Di-N-butyldiphenyltin is InChI=1S/2C6H5.2C4H9.Sn/c2*1-2-4-6-5-3-1;2*1-3-4-2;/h2*1-5H;2*1,3-4H2,2H3.
What is the InChIKey of Di-N-butyldiphenyltin?
The InChIKey of Di-N-butyldiphenyltin is DTYWIPLKZHQUMW-UHFFFAOYSA-N.
What is the Canonical SMILES of Di-N-butyldiphenyltin?
The Canonical SMILES of Di-N-butyldiphenyltin is CCCC[Sn](CCCC)(C1=CC=CC=C1)C2=CC=CC=C2.
What is the CAS number of Di-N-butyldiphenyltin?
The CAS number of Di-N-butyldiphenyltin is 6452-61-5.
What is the European Community (EC) Number of Di-N-butyldiphenyltin?
The European Community (EC) Number of Di-N-butyldiphenyltin is 229-256-3.
What is the UNII of Di-N-butyldiphenyltin?
The UNII of Di-N-butyldiphenyltin is HU6CM55NYA.
What is the formal charge of Di-N-butyldiphenyltin?
The formal charge of Di-N-butyldiphenyltin is 0.