What is the molecular formula of DEPS?
The molecular formula of DEPS is C10H19NO3S.
What are the synonyms for DEPS?
The synonyms for DEPS are 70155-90-7, 3-[diethyl(prop-2-ynyl)azaniumyl]propane-1-sulfonate, 2-PROPYN-1-AMINE,N,N-DIETHYL-N-(3-SULFOPROPYL)HYDROXIDE,INNERSALT, and DTXSID501177380.
What is the molecular weight of DEPS?
The molecular weight of DEPS is 233.33 g/mol.
What is the parent compound of DEPS?
The parent compound of DEPS is Diethyl-prop-2-ynyl-(3-sulfopropyl)azanium.
When was DEPS created and modified?
DEPS was created on September 26, 2005, and last modified on October 21, 2023.
What is the IUPAC name of DEPS?
The IUPAC name of DEPS is 3-[diethyl(prop-2-ynyl)azaniumyl]propane-1-sulfonate.
What is the InChI of DEPS?
The InChI of DEPS is InChI=1S/C10H19NO3S/c1-4-8-11(5-2,6-3)9-7-10-15(12,13)14/h1H,5-10H2,2-3H3.
What is the InChIKey of DEPS?
The InChIKey of DEPS is XTPJLNSARGBDNC-UHFFFAOYSA-N.
What is the canonical SMILES of DEPS?
The canonical SMILES of DEPS is CC[N+](CC)(CCCS(=O)(=O)[O-])CC#C.
What is the CAS number of DEPS?
The CAS number of DEPS is 70155-90-7.