What is the PubChem CID of the compound Decatol?
The PubChem CID of Decatol is 94453.
What is the molecular formula of Decatol?
The molecular formula of Decatol is C13H24O.
What are the synonyms of Decatol?
The synonyms of Decatol include 34131-99-2, 6-ISOPROPYLDECAHYDRONAPHTHALEN-2-OL, Decahydro-6-isopropyl-2-naphthol, and 2-Naphthalenol, decahydro-6-(1-methylethyl)-.
What is the molecular weight of Decatol?
The molecular weight of Decatol is 196.33 g/mol.
When was Decatol created and last modified?
Decatol was created on August 8, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Decatol?
The IUPAC name of Decatol is 6-propan-2-yl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-ol.
What is the InChI of Decatol?
The InChI of Decatol is InChI=1S/C13H24O/c1-9(2)10-3-4-12-8-13(14)6-5-11(12)7-10/h9-14H,3-8H2,1-2H3.
What is the InChIKey of Decatol?
The InChIKey of Decatol is JBMLIVNFPGPRCB-UHFFFAOYSA-N.
What is the canonical SMILES of Decatol?
The canonical SMILES of Decatol is CC(C)C1CCC2CC(CCC2C1)O.
What is the CAS number of Decatol?
The CAS number of Decatol is 34131-99-2.