What is the PubChem CID of D-mannitol?
PubChem CID 6251
What is the molecular formula of D-mannitol?
The molecular formula is C6H14O6.
What is the molecular weight of D-mannitol?
The molecular weight is 182.17 g/mol.
What is the IUPAC Name of D-mannitol?
The IUPAC Name is (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol.
What is the InChI of D-mannitol?
The InChI is InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1.
What is the InChIKey of D-mannitol?
The InChIKey is FBPFZTCFMRRESA-KVTDHHQDSA-N.
What is the CAS number of D-mannitol?
The CAS number is 69-65-8.
What is the synonym for D-mannitol?
The synonym is mannitol.
What are some of the roles of D-mannitol?
D-mannitol has roles as an osmotic diuretic, a sweetening agent, an antiglaucoma drug, a metabolite, an allergen, a hapten, a food bulking agent, a food anticaking agent, a food humectant, a food stabiliser, a food thickening agent, an Escherichia coli metabolite, and a member of compatible osmolytes.
What is the approved use of mannitol by the FDA?
Mannitol was approved by the FDA as add-on maintenance therapy for the control of pulmonary symptoms associated with cystic fibrosis in adult patients.