What is the molecular formula of D-Galacturonic acid according to PubChem CID 439215?
The molecular formula of D-Galacturonic acid is C6H10O7.
When was D-Galacturonic acid first created according to PubChem?
D-Galacturonic acid was first created on June 24, 2005.
What is the molecular weight of D-Galacturonic acid?
The molecular weight of D-Galacturonic acid is 194.14 g/mol.
What is the IUPAC name of D-Galacturonic acid?
The IUPAC name of D-Galacturonic acid is (2S,3R,4S,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid.
What is the Canonical SMILES of D-Galacturonic acid?
The Canonical SMILES of D-Galacturonic acid is C1(C(C(OC(C1O)O)C(=O)O)O)O.
What is the InChIKey of D-Galacturonic acid?
The InChIKey of D-Galacturonic acid is AEMOLEFTQBMNLQ-YMDCURPLSA-N.
What is the CAS number of D-Galacturonic acid?
The CAS number of D-Galacturonic acid is 552-12-5.
How many hydrogen bond donor counts does D-Galacturonic acid have?
D-Galacturonic acid has 5 hydrogen bond donor counts.
What is the topological polar surface area of D-Galacturonic acid?
The topological polar surface area of D-Galacturonic acid is 127 Ų.
How many defined atom stereocenter counts does D-Galacturonic acid have?
D-Galacturonic acid has 4 defined atom stereocenter counts.