What is the molecular formula of D-(+)-Digitoxose?
The molecular formula of D-(+)-Digitoxose is C6H12O4.
What is the molecular weight of D-(+)-Digitoxose?
The molecular weight of D-(+)-Digitoxose is 148.16 g/mol.
What is the IUPAC name of D-(+)-Digitoxose?
The IUPAC name of D-(+)-Digitoxose is (3S,4R,5R)-3,4,5-trihydroxyhexanal.
What is the InChI of D-(+)-Digitoxose?
The InChI of D-(+)-Digitoxose is InChI=1S/C6H12O4/c1-4(8)6(10)5(9)2-3-7/h3-6,8-10H,2H2,1H3/t4-,5+,6-/m1/s1.
What is the InChIKey of D-(+)-Digitoxose?
The InChIKey of D-(+)-Digitoxose is JWFRNGYBHLBCMB-NGJCXOISSA-N.
What is the canonical SMILES of D-(+)-Digitoxose?
The canonical SMILES of D-(+)-Digitoxose is CC(C(C(CC=O)O)O)O.
How many hydrogen bond donor counts does D-(+)-Digitoxose have?
D-(+)-Digitoxose has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does D-(+)-Digitoxose have?
D-(+)-Digitoxose has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of D-(+)-Digitoxose?
The topological polar surface area of D-(+)-Digitoxose is 77.8 ?2.
How many defined atom stereocenter counts does D-(+)-Digitoxose have?
D-(+)-Digitoxose has 3 defined atom stereocenter counts.