What is the PubChem CID of Cyclopropylboronic acid?
The PubChem CID of Cyclopropylboronic acid is 2760897.
What is the molecular formula of Cyclopropylboronic acid?
The molecular formula of Cyclopropylboronic acid is C3H7BO2.
What is the molecular weight of Cyclopropylboronic acid?
The molecular weight of Cyclopropylboronic acid is 85.90 g/mol.
What is the IUPAC name of Cyclopropylboronic acid?
The IUPAC name of Cyclopropylboronic acid is cyclopropylboronic acid.
What is the InChI of Cyclopropylboronic acid?
The InChI of Cyclopropylboronic acid is InChI=1S/C3H7BO2/c5-4(6)3-1-2-3/h3,5-6H,1-2H2.
What is the InChIKey of Cyclopropylboronic acid?
The InChIKey of Cyclopropylboronic acid is WLVKDFJTYKELLQ-UHFFFAOYSA-N.
What is the canonical SMILES of Cyclopropylboronic acid?
The canonical SMILES of Cyclopropylboronic acid is B(C1CC1)(O)O.
What is the CAS number of Cyclopropylboronic acid?
The CAS number of Cyclopropylboronic acid is 411235-57-9.
What is the hydrogen bond donor count of Cyclopropylboronic acid?
The hydrogen bond donor count of Cyclopropylboronic acid is 2.
Is Cyclopropylboronic acid a canonicalized compound?
Yes, Cyclopropylboronic acid is a canonicalized compound.