What is the molecular formula of cyclopropylbenzene?
The molecular formula of cyclopropylbenzene is C9H10.
What is the molecular weight of cyclopropylbenzene?
The molecular weight of cyclopropylbenzene is 118.18 g/mol.
What is the IUPAC name of cyclopropylbenzene?
The IUPAC name of cyclopropylbenzene is cyclopropylbenzene.
What is the InChI code of cyclopropylbenzene?
The InChI code of cyclopropylbenzene is InChI=1S/C9H10/c1-2-4-8(5-3-1)9-6-7-9/h1-5,9H,6-7H2.
What is the InChIKey of cyclopropylbenzene?
The InChIKey of cyclopropylbenzene is VFSFCYAQBIPUSL-UHFFFAOYSA-N.
What is the canonical SMILES of cyclopropylbenzene?
The canonical SMILES of cyclopropylbenzene is C1CC1C2=CC=CC=C2.
What is the CAS number of cyclopropylbenzene?
The CAS number of cyclopropylbenzene is 873-49-4.
What is the XLogP3 value of cyclopropylbenzene?
The XLogP3 value of cyclopropylbenzene is 3.3.
How many hydrogen bond donor counts does cyclopropylbenzene have?
Cyclopropylbenzene has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does cyclopropylbenzene have?
Cyclopropylbenzene has 0 hydrogen bond acceptor counts.