What is the molecular formula of Cyclopentene oxide?
The molecular formula of Cyclopentene oxide is C5H8O.
When was Cyclopentene oxide created in PubChem?
Cyclopentene oxide was created in PubChem on March 26, 2005.
What is the molecular weight of Cyclopentene oxide?
The molecular weight of Cyclopentene oxide is 84.12 g/mol.
What is the IUPAC name of Cyclopentene oxide?
The IUPAC name of Cyclopentene oxide is 6-oxabicyclo[3.1.0]hexane.
What is the InChI of Cyclopentene oxide?
The InChI of Cyclopentene oxide is InChI=1S/C5H8O/c1-2-4-5(3-1)6-4/h4-5H,1-3H2.
What is the InChIKey of Cyclopentene oxide?
The InChIKey of Cyclopentene oxide is GJEZBVHHZQAEDB-UHFFFAOYSA-N.
What is the canonical SMILES of Cyclopentene oxide?
The canonical SMILES of Cyclopentene oxide is C1CC2C(C1)O2.
What is the CAS number of Cyclopentene oxide?
The CAS number of Cyclopentene oxide is 285-67-6.
What is the European Community (EC) number of Cyclopentene oxide?
The European Community (EC) number of Cyclopentene oxide is 206-005-6.
How many hydrogen bond donor counts does Cyclopentene oxide have?
Cyclopentene oxide has 0 hydrogen bond donor counts.