What is the molecular formula of crotonyl glycine?
The molecular formula of crotonyl glycine is C6H9NO3.
What is the molecular weight of crotonyl glycine?
The molecular weight of crotonyl glycine is 143.14 g/mol.
What is the IUPAC name of crotonyl glycine?
The IUPAC name of crotonyl glycine is 2-[[(E)-but-2-enoyl]amino]acetic acid.
What is the InChI of crotonyl glycine?
The InChI of crotonyl glycine is InChI=1S/C6H9NO3/c1-2-3-5(8)7-4-6(9)10/h2-3H,4H2,1H3,(H,7,8)(H,9,10)/b3-2+.
What is the Canonical SMILES of crotonyl glycine?
The Canonical SMILES of crotonyl glycine is CC=CC(=O)NCC(=O)O.
What is the CAS number of crotonyl glycine?
The CAS number of crotonyl glycine is 71428-89-2.
What is the molecular weight of crotonyl glycine according to PubChem?
The molecular weight of crotonyl glycine according to PubChem is 143.14 g/mol.
How many hydrogen bond donor counts does crotonyl glycine have?
Crotonyl glycine has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does crotonyl glycine have?
Crotonyl glycine has 3 hydrogen bond acceptor counts.
Is crotonyl glycine a canonicalized compound?
Yes, crotonyl glycine is a canonicalized compound.