What is the molecular formula of Coumarin 120?
The molecular formula of Coumarin 120 is C10H9NO2.
What is the molecular weight of Coumarin 120?
The molecular weight of Coumarin 120 is 175.18 g/mol.
What is the IUPAC name of Coumarin 120?
The IUPAC name of Coumarin 120 is 7-amino-4-methylchromen-2-one.
What is the InChI of Coumarin 120?
The InChI of Coumarin 120 is InChI=1S/C10H9NO2/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5H,11H2,1H3.
What is the InChIKey of Coumarin 120?
The InChIKey of Coumarin 120 is GLNDAGDHSLMOKX-UHFFFAOYSA-N.
What is the canonical SMILES of Coumarin 120?
The canonical SMILES of Coumarin 120 is CC1=CC(=O)OC2=C1C=CC(=C2)N.
What is the CAS number of Coumarin 120?
The CAS number of Coumarin 120 is 26093-31-2.
What is the ChEMBL ID of Coumarin 120?
The ChEMBL ID of Coumarin 120 is CHEMBL270672.
What is the XLogP3 value of Coumarin 120?
The XLogP3 value of Coumarin 120 is 1.6.
What is the topological polar surface area of Coumarin 120?
The topological polar surface area of Coumarin 120 is 52.3Ų.