What is the molecular formula of coronene?
The molecular formula of coronene is C24H12.
What is the molecular weight of coronene?
The molecular weight of coronene is 300.4 g/mol.
What is the IUPAC name of coronene?
The IUPAC name of coronene is coronene.
What is the InChIKey of coronene?
The InChIKey of coronene is VPUGDVKSAQVFFS-UHFFFAOYSA-N.
What is the canonical SMILES of coronene?
The canonical SMILES of coronene is C1=CC2=C3C4=C1C=CC5=C4C6=C(C=C5)C=CC7=C6C3=C(C=C2)C=C7.
What is the CAS number of coronene?
The CAS number of coronene is 191-07-1.
What is the molecular weight of coronene according to PubChem?
The molecular weight of coronene is 300.4 g/mol according to PubChem.
What is the XLogP3 value of coronene?
The XLogP3 value of coronene is 7.2.
What is the hydrogen bond donor count of coronene?
The hydrogen bond donor count of coronene is 0.
What is the topological polar surface area of coronene?
The topological polar surface area of coronene is 0Ų.