What is the molecular formula of Cophylline?
The molecular formula of Cophylline is C44H50N4O10.
What are the synonyms of Cophylline?
The synonyms of Cophylline are Conophylline and Dimethyl 14,25-diethyl-24,33-dihydroxy-31,32-dimethoxy-12,22-dioxa-1,9,18,29-tetrazadodecacyclo[23.13.1.16,9.02,23.03,21.05,19.06,17.011,13.028,36.030,35.036,39.014,40]tetraconta-3,5(19),16,20,27,30,32,34-octaene-16,27-dicarboxylate.
What is the PubChem CID of Cophylline?
The PubChem CID of Cophylline is 9853848.
What is the molecular weight of Cophylline?
The molecular weight of Cophylline is 794.9 g/mol.
How is the molecular weight of Cophylline computed?
The molecular weight of Cophylline is computed by PubChem 2.1.
When was Cophylline created?
Cophylline was created on October 25, 2006.
When was Cophylline last modified?
Cophylline was last modified on December 30, 2023.
What is the IUPAC name of Cophylline?
The IUPAC name of Cophylline is dimethyl 14,25-diethyl-24,33-dihydroxy-31,32-dimethoxy-12,22-dioxa-1,9,18,29-tetrazadodecacyclo[23.13.1.16,9.02,23.03,21.05,19.06,17.011,13.028,36.030,35.036,39.014,40]tetraconta-3,5(19),16,20,27,30,32,34-octaene-16,27-dicarboxylate.
What is the InChI key of Cophylline?
The InChI key of Cophylline is QZRIMAMDGWAHPQ-UHFFFAOYSA-N.
What is the canonical SMILES of Cophylline?
The canonical SMILES of Cophylline is CCC12CC(=C3C4(C1N(CC4)C5C(C2O)OC6=CC7=C(C=C56)C89CCN1C8C(CC(=C9N7)C(=O)OC)(C2C(C1)O2)CC)C1=CC(=C(C(=C1N3)OC)OC)O)C(=O)OC.