What is the molecular formula of clobetasone?
The molecular formula of clobetasone is C22H26ClFO4.
What is the molecular weight of clobetasone?
The molecular weight of clobetasone is 408.9 g/mol.
What is the IUPAC name of clobetasone?
The IUPAC name of clobetasone is (8S,9R,10S,13S,14S,16S,17R)-17-(2-chloroacetyl)-9-fluoro-17-hydroxy-10,13,16-trimethyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-3,11-dione.
What is the InChIKey of clobetasone?
The InChIKey of clobetasone is XXIFVOHLGBURIG-OZCCCYNHSA-N.
What is the Canonical SMILES of clobetasone?
The Canonical SMILES of clobetasone is CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(=O)CC2(C1(C(=O)CCl)O)C)F)C.
What is the CAS number of clobetasone?
The CAS number of clobetasone is 54063-32-0.
What is the UNII of clobetasone?
The UNII of clobetasone is LT69WY1J6D.
What is the KEGG ID of clobetasone?
The KEGG ID of clobetasone is D07717.
What is the XLogP3 value of clobetasone?
The XLogP3 value of clobetasone is 2.6.