What is the molecular formula of Clemizole hydrochloride?
The molecular formula of Clemizole hydrochloride is C19H21Cl2N3.
What is the molecular weight of Clemizole hydrochloride?
The molecular weight of Clemizole hydrochloride is 362.3 g/mol.
What is the IUPAC name of Clemizole hydrochloride?
The IUPAC name of Clemizole hydrochloride is 1-[(4-chlorophenyl)methyl]-2-(pyrrolidin-1-ylmethyl)benzimidazole;hydrochloride.
What is the InChI of Clemizole hydrochloride?
The InChI of Clemizole hydrochloride is InChI=1S/C19H20ClN3.ClH/c20-16-9-7-15(8-10-16)13-23-18-6-2-1-5-17(18)21-19(23)14-22-11-3-4-12-22;/h1-2,5-10H,3-4,11-14H2;1H.
What is the Canonical SMILES of Clemizole hydrochloride?
The Canonical SMILES of Clemizole hydrochloride is C1CCN(C1)CC2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)Cl.Cl.
What is the CAS number of Clemizole hydrochloride?
The CAS number of Clemizole hydrochloride is 1163-36-6.
What is the UNII of Clemizole hydrochloride?
The UNII of Clemizole hydrochloride is 85W6I13D8M.
What is the ChEMBL ID of Clemizole hydrochloride?
The ChEMBL ID of Clemizole hydrochloride is CHEMBL1256817.
What is the NCI Thesaurus Code of Clemizole hydrochloride?
The NCI Thesaurus Code of Clemizole hydrochloride is C81152.