What is the molecular formula of cis-Piceatannol?
The molecular formula of cis-Piceatannol is C14H12O4.
What is the molecular weight of cis-Piceatannol?
The molecular weight of cis-Piceatannol is 244.24 g/mol.
What is the IUPAC name of cis-Piceatannol?
The IUPAC name of cis-Piceatannol is 4-[(Z)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol.
What is the InChI of cis-Piceatannol?
The InChI of cis-Piceatannol is InChI=1S/C14H12O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h1-8,15-18H/b2-1-.
What is the InChIKey of cis-Piceatannol?
The InChIKey of cis-Piceatannol is CDRPUGZCRXZLFL-UPHRSURJSA-N.
What is the canonical SMILES of cis-Piceatannol?
The canonical SMILES of cis-Piceatannol is C1=CC(=C(C=C1C=CC2=CC(=CC(=C2)O)O)O)O.
What is the CAS number of cis-Piceatannol?
The CAS number of cis-Piceatannol is 106325-86-4.
What is the ChEMBL ID of cis-Piceatannol?
The ChEMBL ID of cis-Piceatannol is CHEMBL1603409.
What is the formal charge of cis-Piceatannol?
The formal charge of cis-Piceatannol is 0.