What is the molecular formula of the compound?
The molecular formula is C19H19N3O.
What is the molecular weight of the compound?
The molecular weight is 305.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is tris(4-aminophenyl)methanol.
What is the InChI code of the compound?
The InChI code is InChI=1S/C19H19N3O/c20-16-7-1-13(2-8-16)19(23,14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15/h1-12,23H,20-22H2.
What is the InChIKey of the compound?
The InChIKey is KRVRUAYUNOQMOV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C3=CC=C(C=C3)N)O)N.
What is the CAS number of the compound?
The CAS number is 467-62-9.
What is the EC number of the compound?
The EC number is 207-395-0.
What is the ChEMBL ID of the compound?
The ChEMBL ID is CHEMBL119866.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is 2.2.