What is the PubChem CID for Chlorfenapyr?
The PubChem CID for Chlorfenapyr is 91778.
What is the molecular formula of Chlorfenapyr?
The molecular formula of Chlorfenapyr is C15H11BrClF3N2O.
What are the synonyms for Chlorfenapyr?
The synonyms for Chlorfenapyr include Pirate, Pylon, and 4-Bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile.
What is the molecular weight of Chlorfenapyr?
The molecular weight of Chlorfenapyr is 407.61 g/mol.
What is the IUPAC name of Chlorfenapyr?
The IUPAC name of Chlorfenapyr is 4-bromo-2-(4-chlorophenyl)-1-(ethoxymethyl)-5-(trifluoromethyl)pyrrole-3-carbonitrile.
What is the InChI of Chlorfenapyr?
The InChI of Chlorfenapyr is InChI=1S/C15H11BrClF3N2O/c1-2-23-8-22-13(9-3-5-10(17)6-4-9)11(7-21)12(16)14(22)15(18,19)20/h3-6H,2,8H2,1H3.
What is the InChIKey of Chlorfenapyr?
The InChIKey of Chlorfenapyr is CWFOCCVIPCEQCK-UHFFFAOYSA-N.
What is the canonical SMILES of Chlorfenapyr?
The canonical SMILES of Chlorfenapyr is CCOCN1C(=C(C(=C1C(F)(F)F)Br)C#N)C2=CC=C(C=C2)Cl.
What is the CAS number of Chlorfenapyr?
The CAS number of Chlorfenapyr is 122453-73-0.