What is the PubChem CID of H-Tyr-gly-nh2 hcl?
The PubChem CID of H-Tyr-gly-nh2 hcl is 90477895.
What is the molecular formula of H-Tyr-gly-nh2 hcl?
The molecular formula of H-Tyr-gly-nh2 hcl is C11H16ClN3O3.
What is the molecular weight of H-Tyr-gly-nh2 hcl?
The molecular weight of H-Tyr-gly-nh2 hcl is 273.71 g/mol.
What is the parent compound of H-Tyr-gly-nh2?
The parent compound of H-Tyr-gly-nh2 is l-Tyrosylglycinamide (CID 7015187).
What are the synonyms of H-Tyr-gly-nh2 hcl?
The synonyms of H-Tyr-gly-nh2 hcl include 99940-62-2, H-Tyr-Gly-NH2.HCl, H-TYR-GLY-NH2 HCL, and more.
What is the IUPAC name of H-Tyr-gly-nh2 hcl?
The IUPAC name of H-Tyr-gly-nh2 hcl is (2S)-2-amino-N-(2-amino-2-oxoethyl)-3-(4-hydroxyphenyl)propanamide;hydrochloride.
What is the InChI of H-Tyr-gly-nh2 hcl?
The InChI of H-Tyr-gly-nh2 hcl is InChI=1S/C11H15N3O3.ClH/c12-9(11(17)14-6-10(13)16)5-7-1-3-8(15)4-2-7;/h1-4,9,15H,5-6,12H2,(H2,13,16)(H,14,17);1H/t9-;/m0./s1.
What is the InChIKey of H-Tyr-gly-nh2 hcl?
The InChIKey of H-Tyr-gly-nh2 hcl is DTFLEXYAKADQLH-FVGYRXGTSA-N.
What is the canonical SMILES of H-Tyr-gly-nh2 hcl?
The canonical SMILES of H-Tyr-gly-nh2 hcl is C1=CC(=CC=C1CC(C(=O)NCC(=O)N)N)O.Cl.
What is the hydrogen bond donor count of H-Tyr-gly-nh2 hcl?
The hydrogen bond donor count of H-Tyr-gly-nh2 hcl is 5.