What is the molecular formula of (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile?
The molecular formula is C11H10N6.
What is the molecular weight of (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile?
The molecular weight is 226.24 g/mol.
What are the synonyms of (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile?
The synonyms include 99845-72-4, 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile, 2-(4-Amino-6-(phenylamino)-1,3,5-triazin-2-yl)acetonitrile, and DTXSID40429352.
When was (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile created?
It was created on July 30, 2006.
When was (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile?
The IUPAC name is 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile.
What is the InChI key of (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile?
The InChI key is WUDAGWKSEJVISS-UHFFFAOYSA-N.
What is the canonical SMILES of (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile?
The canonical SMILES is C1=CC=C(C=C1)NC2=NC(=NC(=N2)N)CC#N.
What is the XLogP3-AA value of (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile?
The XLogP3-AA value is 1.2.
What is the hydrogen bond donor count of (4-Amino-6-anilino-1,3,5-triazin-2-yl)acetonitrile?
The hydrogen bond donor count is 2.
※ Please kindly note that our products are for research use only.