What is the molecular formula of the compound with the PubChem CID 90477965?
The molecular formula is C13H22O.
What are the synonyms of the compound with the PubChem CID 90477965?
The synonyms are 99745-11-6, 6,8-Nonadien-2-one, 8-methyl-5-(1-methylethyl)-, [R-(Z)]-, [R-(Z)]-5-isopropyl-8-methylnona-6,8-dien-2-one, SCHEMBL24089836, and DTXSID701195156.
What is the molecular weight of the compound with the PubChem CID 90477965?
The molecular weight is 194.31 g/mol.
What is the IUPAC name of the compound with the PubChem CID 90477965?
The IUPAC name is (5R,6Z)-8-methyl-5-propan-2-ylnona-6,8-dien-2-one.
What is the InChI of the compound with the PubChem CID 90477965?
The InChI is InChI=1S/C13H22O/c1-10(2)6-8-13(11(3)4)9-7-12(5)14/h6,8,11,13H,1,7,9H2,2-5H3/b8-6-/t13-/m1/s1.
What is the InChIKey of the compound with the PubChem CID 90477965?
The InChIKey is PQDRXUSSKFWCFA-FWPCIQOSSA-N.
What is the canonical SMILES of the compound with the PubChem CID 90477965?
The canonical SMILES is CC(C)C(CCC(=O)C)C=CC(=C)C.
How many hydrogen bond donor counts does the compound with the PubChem CID 90477965 have?
The compound has 0 hydrogen bond donor count.
How many rotatable bond counts does the compound with the PubChem CID 90477965 have?
The compound has 6 rotatable bond counts.
Is the compound with the PubChem CID 90477965 canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.