What is the PubChem CID of 4-Vinylbenzocyclobutene?
The PubChem CID of 4-Vinylbenzocyclobutene is 22172249.
What is the molecular formula of 4-Vinylbenzocyclobutene?
The molecular formula of 4-Vinylbenzocyclobutene is C10H10.
What is the molecular weight of 4-Vinylbenzocyclobutene?
The molecular weight of 4-Vinylbenzocyclobutene is 130.19 g/mol.
What is the IUPAC Name of 4-Vinylbenzocyclobutene?
The IUPAC Name of 4-Vinylbenzocyclobutene is 3-ethenylbicyclo[4.2.0]octa-1(6),2,4-triene.
What is the InChI of 4-Vinylbenzocyclobutene?
The InChI of 4-Vinylbenzocyclobutene is InChI=1S/C10H10/c1-2-8-3-4-9-5-6-10(9)7-8/h2-4,7H,1,5-6H2.
What is the InChIKey of 4-Vinylbenzocyclobutene?
The InChIKey of 4-Vinylbenzocyclobutene is DTGDMPJDZKDHEP-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Vinylbenzocyclobutene?
The Canonical SMILES of 4-Vinylbenzocyclobutene is C=CC1=CC2=C(CC2)C=C1.
What is the CAS number of 4-Vinylbenzocyclobutene?
The CAS number of 4-Vinylbenzocyclobutene is 99717-87-0.
What is the European Community (EC) Number of 4-Vinylbenzocyclobutene?
The European Community (EC) Number of 4-Vinylbenzocyclobutene is 663-548-5.
Is 4-Vinylbenzocyclobutene a covalently-bonded unit?
Yes, 4-Vinylbenzocyclobutene is a covalently-bonded unit.