What is the molecular formula of Chembrdg-bb 4010237?
The molecular formula of Chembrdg-bb 4010237 is C13H8BrNO.
What is the molecular weight of Chembrdg-bb 4010237?
The molecular weight of Chembrdg-bb 4010237 is 274.11 g/mol.
When was Chembrdg-bb 4010237 created?
Chembrdg-bb 4010237 was created on July 9, 2005.
When was Chembrdg-bb 4010237 last modified?
Chembrdg-bb 4010237 was last modified on December 30, 2023.
What is the IUPAC name of Chembrdg-bb 4010237?
The IUPAC name of Chembrdg-bb 4010237 is 2-(3-bromophenyl)-1,3-benzoxazole.
What is the InChI of Chembrdg-bb 4010237?
The InChI of Chembrdg-bb 4010237 is InChI=1S/C13H8BrNO/c14-10-5-3-4-9(8-10)13-15-11-6-1-2-7-12(11)16-13/h1-8H.
What is the InChIKey of Chembrdg-bb 4010237?
The InChIKey of Chembrdg-bb 4010237 is KHEXVASQRAJENK-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 4010237?
The canonical SMILES of Chembrdg-bb 4010237 is C1=CC=C2C(=C1)N=C(O2)C3=CC(=CC=C3)Br.
What is the CAS number of Chembrdg-bb 4010237?
The CAS number of Chembrdg-bb 4010237 is 99586-31-9.
What is the molecular weight of Chembrdg-bb 4010237 according to PubChem?
According to PubChem, the molecular weight of Chembrdg-bb 4010237 is 274.11 g/mol.