What is the molecular formula of R-(-)-Flecainide?
The molecular formula of R-(-)-Flecainide is C17H20F6N2O3.
What is the molecular weight of R-(-)-Flecainide?
The molecular weight of R-(-)-Flecainide is 414.34 g/mol.
What is the IUPAC name of R-(-)-Flecainide?
The IUPAC name of R-(-)-Flecainide is N-[[(2R)-piperidin-2-yl]methyl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide.
What is the InChI of R-(-)-Flecainide?
The InChI of R-(-)-Flecainide is InChI=1S/C17H20F6N2O3/c18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11/h4-5,7,11,24H,1-3,6,8-10H2,(H,25,26)/t11-/m1/s1.
What is the InChIKey of R-(-)-Flecainide?
The InChIKey of R-(-)-Flecainide is DJBNUMBKLMJRSA-LLVKDONJSA-N.
What is the canonical SMILES of R-(-)-Flecainide?
The canonical SMILES of R-(-)-Flecainide is C1CCNC(C1)CNC(=O)C2=C(C=CC(=C2)OCC(F)(F)F)OCC(F)(F)F.
What is the CAS number of R-(-)-Flecainide?
The CAS number of R-(-)-Flecainide is 99495-90-6.
What is the ChEMBL ID of R-(-)-Flecainide?
The ChEMBL ID of R-(-)-Flecainide is CHEMBL398673.
Is R-(-)-Flecainide a canonicalized compound?
Yes, R-(-)-Flecainide is a canonicalized compound.