What is the molecular formula of Carboxyterbinafine?
The molecular formula of Carboxyterbinafine is C21H23NO2.
What is the molecular weight of Carboxyterbinafine?
The molecular weight of Carboxyterbinafine is 321.4 g/mol.
What is the IUPAC name of Carboxyterbinafine?
The IUPAC name of Carboxyterbinafine is (E)-2,2-dimethyl-7-[methyl(naphthalen-1-ylmethyl)amino]hept-5-en-3-ynoic acid.
What is the InChI of Carboxyterbinafine?
The InChI of Carboxyterbinafine is InChI=1S/C21H23NO2/c1-21(2,20(23)24)14-7-4-8-15-22(3)16-18-12-9-11-17-10-5-6-13-19(17)18/h4-6,8-13H,15-16H2,1-3H3,(H,23,24)/b8-4+.
What is the InChIKey of Carboxyterbinafine?
The InChIKey of Carboxyterbinafine is DSPCPJFHUUUMEV-XBXARRHUSA-N.
What is the Canonical SMILES of Carboxyterbinafine?
The Canonical SMILES of Carboxyterbinafine is CC(C)(C#CC=CCN(C)CC1=CC=CC2=CC=CC=C21)C(=O)O.
How many hydrogen bond donor counts does Carboxyterbinafine have?
Carboxyterbinafine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Carboxyterbinafine have?
Carboxyterbinafine has 3 hydrogen bond acceptor counts.
Does Carboxyterbinafine have defined bond stereocenter count?
Yes, Carboxyterbinafine has 1 defined bond stereocenter count.