What is the PubChem CID of (+)-Dehydroabietylamine?
The PubChem CID of (+)-Dehydroabietylamine is 62034.
What is the molecular formula of (+)-Dehydroabietylamine?
The molecular formula of (+)-Dehydroabietylamine is C20H31N.
What is the molecular weight of (+)-Dehydroabietylamine?
The molecular weight of (+)-Dehydroabietylamine is 285.5 g/mol.
What is the IUPAC name of (+)-Dehydroabietylamine?
The IUPAC name of (+)-Dehydroabietylamine is [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine.
What is the InChIKey of (+)-Dehydroabietylamine?
The InChIKey of (+)-Dehydroabietylamine is JVVXZOOGOGPDRZ-SLFFLAALSA-N.
What is the Canonical SMILES of (+)-Dehydroabietylamine?
The Canonical SMILES of (+)-Dehydroabietylamine is CC(C)C1=CC2=C(C=C1)C3(CCCC(C3CC2)(C)CN)C.
What is the CAS number of (+)-Dehydroabietylamine?
The CAS number of (+)-Dehydroabietylamine is 1446-61-3.
What is the XLogP3-AA value of (+)-Dehydroabietylamine?
The XLogP3-AA value of (+)-Dehydroabietylamine is 5.4.
How many hydrogen bond donor count does (+)-Dehydroabietylamine have?
(+)-Dehydroabietylamine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does (+)-Dehydroabietylamine have?
(+)-Dehydroabietylamine has 1 hydrogen bond acceptor count.