What is the molecular formula of Levodropropizine?
The molecular formula of Levodropropizine is C13H20N2O2.
What is the molecular weight of Levodropropizine?
The molecular weight of Levodropropizine is 236.31 g/mol.
What are the synonyms of Levodropropizine?
The synonyms of Levodropropizine include Levotuss and Danka.
What is the IUPAC name of Levodropropizine?
The IUPAC name of Levodropropizine is (2S)-3-(4-phenylpiperazin-1-yl)propane-1,2-diol.
What is the InChI of Levodropropizine?
The InChI of Levodropropizine is InChI=1S/C13H20N2O2/c16-11-13(17)10-14-6-8-15(9-7-14)12-4-2-1-3-5-12/h1-5,13,16-17H,6-11H2/t13-/m0/s1.
What is the InChIKey of Levodropropizine?
The InChIKey of Levodropropizine is PTVWPYVOOKLBCG-ZDUSSCGKSA-N.
What is the canonical SMILES of Levodropropizine?
The canonical SMILES of Levodropropizine is C1CN(CCN1CC(CO)O)C2=CC=CC=C2.
What is the CAS number of Levodropropizine?
The CAS number of Levodropropizine is 99291-25-5.
What is the UNII of Levodropropizine?
The UNII of Levodropropizine is 3O31P6T4G3.