What is the PubChem CID of Sulcotrione?
The PubChem CID of Sulcotrione is 91760.
What is the molecular formula of Sulcotrione?
The molecular formula of Sulcotrione is C14H13ClO5S.
What are the synonyms of Sulcotrione?
The synonyms of Sulcotrione include Sulcotrione, 99105-77-8, 2-(2-Chloro-4-(methylsulfonyl)benzoyl)cyclohexane-1,3-dione, and 2-(2-chloro-4-methylsulfonylbenzoyl)cyclohexane-1,3-dione.
What is the molecular weight of Sulcotrione?
The molecular weight of Sulcotrione is 328.8 g/mol.
When was Sulcotrione created and modified?
Sulcotrione was created on August 8, 2005, and modified on December 30, 2023.
What is the role of Sulcotrione?
Sulcotrione has a role as an environmental contaminant, a xenobiotic, a herbicide, and a carotenoid biosynthesis inhibitor.
What is the IUPAC name of Sulcotrione?
The IUPAC name of Sulcotrione is 2-(2-chloro-4-methylsulfonylbenzoyl)cyclohexane-1,3-dione.
What is the InChIKey of Sulcotrione?
The InChIKey of Sulcotrione is PQTBTIFWAXVEPB-UHFFFAOYSA-N.
What is the canonical SMILES of Sulcotrione?
The canonical SMILES of Sulcotrione is CS(=O)(=O)C1=CC(=C(C=C1)C(=O)C2C(=O)CCCC2=O)Cl.
What is the CAS number of Sulcotrione?
The CAS number of Sulcotrione is 99105-77-8.