What is the molecular formula of iofendylate?
The molecular formula of iofendylate is C19H29IO2.
What is the molecular weight of iofendylate?
The molecular weight of iofendylate is 416.3 g/mol.
What is the IUPAC name of iofendylate?
The IUPAC name of iofendylate is ethyl 10-(4-iodophenyl)undecanoate.
What is the InChI of iofendylate?
The InChI of iofendylate is InChI=1S/C19H29IO2/c1-3-22-19(21)11-9-7-5-4-6-8-10-16(2)17-12-14-18(20)15-13-17/h12-16H,3-11H2,1-2H3.
What is the InChIKey of iofendylate?
The InChIKey of iofendylate is LAYLQVBQIBQVLL-UHFFFAOYSA-N.
What is the canonical SMILES of iofendylate?
The canonical SMILES of iofendylate is CCOC(=O)CCCCCCCCC(C)C1=CC=C(C=C1)I.
What is the CAS number of iofendylate?
The CAS number of iofendylate is 99-79-6.
What is the European Community (EC) number of iofendylate?
The European Community (EC) number of iofendylate is 202-787-8.
What is the UNII of iofendylate?
The UNII of iofendylate is 6V3I57K9UL.