What is the molecular formula of Ethyl 4-nitrobenzoate?
The molecular formula of Ethyl 4-nitrobenzoate is C9H9NO4.
What is the molecular weight of Ethyl 4-nitrobenzoate?
The molecular weight of Ethyl 4-nitrobenzoate is 195.17 g/mol.
What is the IUPAC name of Ethyl 4-nitrobenzoate?
The IUPAC name of Ethyl 4-nitrobenzoate is ethyl 4-nitrobenzoate.
What is the InChI of Ethyl 4-nitrobenzoate?
The InChI of Ethyl 4-nitrobenzoate is InChI=1S/C9H9NO4/c1-2-14-9(11)7-3-5-8(6-4-7)10(12)13/h3-6H,2H2,1H3.
What is the InChIKey of Ethyl 4-nitrobenzoate?
The InChIKey of Ethyl 4-nitrobenzoate is PHWSCBWNPZDYRI-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 4-nitrobenzoate?
The canonical SMILES of Ethyl 4-nitrobenzoate is CCOC(=O)C1=CC=C(C=C1)[N+](=O)[O-].
What is the CAS number of Ethyl 4-nitrobenzoate?
The CAS number of Ethyl 4-nitrobenzoate is 99-77-4.
What is the European Community (EC) number of Ethyl 4-nitrobenzoate?
The European Community (EC) number of Ethyl 4-nitrobenzoate is 202-786-2.
What is the DSSTox Substance ID of Ethyl 4-nitrobenzoate?
The DSSTox Substance ID of Ethyl 4-nitrobenzoate is DTXSID1052666.
What is the XLogP3 value of Ethyl 4-nitrobenzoate?
The XLogP3 value of Ethyl 4-nitrobenzoate is 2.3.