What is the molecular formula of 4-sec-Butylphenol?
The molecular formula of 4-sec-Butylphenol is C10H14O.
What is the molecular weight of 4-sec-Butylphenol?
The molecular weight of 4-sec-Butylphenol is 150.22 g/mol.
What is the IUPAC name of 4-sec-Butylphenol?
The IUPAC name of 4-sec-Butylphenol is 4-butan-2-ylphenol.
What is the InChI of 4-sec-Butylphenol?
The InChI of 4-sec-Butylphenol is InChI=1S/C10H14O/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8,11H,3H2,1-2H3.
What is the InChIKey of 4-sec-Butylphenol?
The InChIKey of 4-sec-Butylphenol is ZUTYZAFDFLLILI-UHFFFAOYSA-N.
What is the canonical SMILES of 4-sec-Butylphenol?
The canonical SMILES of 4-sec-Butylphenol is CCC(C)C1=CC=C(C=C1)O.
What is the CAS number of 4-sec-Butylphenol?
The CAS number of 4-sec-Butylphenol is 99-71-8.
What is the European Community (EC) number of 4-sec-Butylphenol?
The European Community (EC) number of 4-sec-Butylphenol is 202-781-5.
What is the ChEMBL ID of 4-sec-Butylphenol?
The ChEMBL ID of 4-sec-Butylphenol is CHEMBL29398.
What is the Monoisotopic Mass of 4-sec-Butylphenol?
The Monoisotopic Mass of 4-sec-Butylphenol is 150.104465066 g/mol.
Download
