What is the molecular formula of M-Toluic Acid?
The molecular formula of M-Toluic Acid is C8H8O2.
What is the molecular weight of M-Toluic Acid?
The molecular weight of M-Toluic Acid is 136.15 g/mol.
What is the IUPAC name of M-Toluic Acid?
The IUPAC name of M-Toluic Acid is 3-methylbenzoic acid.
What is the InChI of M-Toluic Acid?
The InChI of M-Toluic Acid is InChI=1S/C8H8O2/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10).
What is the InChIKey of M-Toluic Acid?
The InChIKey of M-Toluic Acid is GPSDUZXPYCFOSQ-UHFFFAOYSA-N.
What is the CAS number of M-Toluic Acid?
The CAS number of M-Toluic Acid is 99-04-7.
What is the XLogP3 value of M-Toluic Acid?
The XLogP3 value of M-Toluic Acid is 2.4.
How many Hydrogen Bond Donor Count does M-Toluic Acid have?
M-Toluic Acid has 1 Hydrogen Bond Donor Count.
How many Hydrogen Bond Acceptor Count does M-Toluic Acid have?
M-Toluic Acid has 2 Hydrogen Bond Acceptor Count.
What is the Topological Polar Surface Area of M-Toluic Acid?
The Topological Polar Surface Area of M-Toluic Acid is 37.3 ?2.
How many hydrogen bond donor counts does m-Toluic acid have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does m-Toluic acid have?
It has 2 hydrogen bond acceptor counts.