What is the molecular formula of 3,5-dinitrobenzoic acid?
The molecular formula of 3,5-dinitrobenzoic acid is C7H4N2O6.
What is the molecular weight of 3,5-dinitrobenzoic acid?
The molecular weight of 3,5-dinitrobenzoic acid is 212.12 g/mol.
How is the IUPAC name of 3,5-dinitrobenzoic acid computed?
The IUPAC name of 3,5-dinitrobenzoic acid is computed by Lexichem TK 2.7.0.
What is the InChI of 3,5-dinitrobenzoic acid?
The InChI of 3,5-dinitrobenzoic acid is "InChI=1S/C7H4N2O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)".
What is the InChIKey of 3,5-dinitrobenzoic acid?
The InChIKey of 3,5-dinitrobenzoic acid is "VYWYYJYRVSBHJQ-UHFFFAOYSA-N".
What is the canonical SMILES of 3,5-dinitrobenzoic acid?
The canonical SMILES of 3,5-dinitrobenzoic acid is "C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)O".
What is the CAS number of 3,5-dinitrobenzoic acid?
The CAS number of 3,5-dinitrobenzoic acid is 99-34-3.
What is the UNII of 3,5-dinitrobenzoic acid?
The UNII of 3,5-dinitrobenzoic acid is 4V3F9Q018P.
What is the ChEMBL ID of 3,5-dinitrobenzoic acid?
The ChEMBL ID of 3,5-dinitrobenzoic acid is CHEMBL118713.
What is the Wikipedia page for 3,5-dinitrobenzoic acid?
The Wikipedia page for 3,5-dinitrobenzoic acid is "3,5-Dinitrobenzoic_acid".