What is the CID number of Boron methoxyethoxide?
The CID number of Boron methoxyethoxide is 84742.
What is the molecular formula of Boron methoxyethoxide?
The molecular formula of Boron methoxyethoxide is C9H21BO6.
What is the synonyms of Boron methoxyethoxide?
The synonyms of Boron methoxyethoxide are tris(2-methoxyethyl)borate, 14983-42-7, tris(2-methoxyethyl) borate, Tris(2-methoxyethyl) orthoborate, and BORON METHOXYETHOXIDE.
What is the molecular weight of Boron methoxyethoxide?
The molecular weight of Boron methoxyethoxide is 236.07 g/mol.
What is the IUPAC name of Boron methoxyethoxide?
The IUPAC name of Boron methoxyethoxide is tris(2-methoxyethyl) borate.
What is the InChI of Boron methoxyethoxide?
The InChI of Boron methoxyethoxide is InChI=1S/C9H21BO6/c1-11-4-7-14-10(15-8-5-12-2)16-9-6-13-3/h4-9H2,1-3H3.
What is the InChIKey of Boron methoxyethoxide?
The InChIKey of Boron methoxyethoxide is IYGPXXORQKFXCZ-UHFFFAOYSA-N.
What is the canonical SMILES of Boron methoxyethoxide?
The canonical SMILES of Boron methoxyethoxide is B(OCCOC)(OCCOC)OCCOC.
What is the CAS number of Boron methoxyethoxide?
The CAS number of Boron methoxyethoxide is 14983-42-7.
Is Boron methoxyethoxide a covalently-bonded unit?
Yes, Boron methoxyethoxide is a covalently-bonded unit.