What is the molecular formula of z-Tyr-glu-oh?
The molecular formula of z-Tyr-glu-oh is C22H24N2O8.
What is the molecular weight of z-Tyr-glu-oh?
The molecular weight of z-Tyr-glu-oh is 444.4 g/mol.
What is the IUPAC name of z-Tyr-glu-oh?
The IUPAC name of z-Tyr-glu-oh is (2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanedioic acid.
What is the InChI of z-Tyr-glu-oh?
The InChI of z-Tyr-glu-oh is InChI=1S/C22H24N2O8/c25-16-8-6-14(7-9-16)12-18(20(28)23-17(21(29)30)10-11-19(26)27)24-22(31)32-13-15-4-2-1-3-5-15/h1-9,17-18,25H,10-13H2,(H,23,28)(H,24,31)(H,26,27)(H,29,30)/t17-,18-/m0/s1.
What is the InChIKey of z-Tyr-glu-oh?
The InChIKey of z-Tyr-glu-oh is ARAWERCUGGAGFN-ROUUACIJSA-N.
What is the canonical SMILES of z-Tyr-glu-oh?
The canonical SMILES of z-Tyr-glu-oh is C1=CC=C(C=C1)COC(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CCC(=O)O)C(=O)O.
What is the CAS number of z-Tyr-glu-oh?
The CAS number of z-Tyr-glu-oh is 988-70-5.
What is the XLogP3 value of z-Tyr-glu-oh?
The XLogP3 value of z-Tyr-glu-oh is 1.
What is the hydrogen bond donor count of z-Tyr-glu-oh?
The hydrogen bond donor count of z-Tyr-glu-oh is 5.