What is the molecular formula of ropivacaine mesylate?
The molecular formula of ropivacaine mesylate is C18H30N2O4S.
When was ropivacaine mesylate created and last modified?
Ropivacaine mesylate was created on 2008-05-19 and last modified on 2023-12-30.
What is the IUPAC name of ropivacaine mesylate?
The IUPAC name of ropivacaine mesylate is (2S)-N-(2,6-dimethylphenyl)-1-propylpiperidine-2-carboxamide;methanesulfonic acid.
What is the molecular weight of ropivacaine mesylate?
The molecular weight of ropivacaine mesylate is 370.5 g/mol.
What is the Canonical SMILES of ropivacaine mesylate?
The Canonical SMILES of ropivacaine mesylate is CCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C.CS(=O)(=O)O.
What is the InChIKey of ropivacaine mesylate?
The InChIKey of ropivacaine mesylate is YPTSIOMXZOPKAF-RSAXXLAASA-N.
How many hydrogen bond donor counts does ropivacaine mesylate have?
Ropivacaine mesylate has 2 hydrogen bond donor counts.
What is the topological polar surface area of ropivacaine mesylate?
The topological polar surface area of ropivacaine mesylate is 95.1 Å^2.
How many heavy atoms are present in the structure of ropivacaine mesylate?
There are 25 heavy atoms present in the structure of ropivacaine mesylate.
Is ropivacaine mesylate considered a canonicalized compound?
Yes, ropivacaine mesylate is considered a canonicalized compound.