The synonyms of the compound include 1-methyl-1H-pyrazole-5-carboxamide, 98711-43-4, 2-methylpyrazole-3-carboxamide, and 2-Methyl-2H-pyrazole-3-carboxylic acid amide.
What is the molecular weight of the compound?
The molecular weight of the compound is 125.13 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-methylpyrazole-3-carboxamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C5H7N3O/c1-8-4(5(6)9)2-3-7-8/h2-3H,1H3,(H2,6,9).
What is the InChIKey of the compound?
The InChIKey of the compound is MFMKTVNIVSWSTK-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CN1C(=CC=N1)C(=O)N.
What is the ChEMBL ID of the compound?
The ChEMBL ID of the compound is CHEMBL4591091.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is -0.6.
How many hydrogen bond donor counts does the compound have?
The compound has one hydrogen bond donor count.
※ Please kindly note that our products are for research use only.