What is the molecular formula of Raclopride?
The molecular formula of Raclopride is C15H20Cl2N2O3.
What is the molecular weight of Raclopride?
The molecular weight of Raclopride is 347.2 g/mol.
What are some synonyms for Raclopride?
Some synonyms for Raclopride include RACLOPRIDE 84225-95-6 and (S)-3,5-dichloro-N-((1-ethylpyrrolidin-2-yl)methyl)-2-hydroxy-6-methoxybenzamide.
What is the description of Raclopride?
Raclopride is described as a member of salicylamides and has been used in trials studying Parkinson Disease.
What is the IUPAC name of Raclopride?
The IUPAC name of Raclopride is 3,5-dichloro-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-2-hydroxy-6-methoxybenzamide.
What is the InChIKey of Raclopride?
The InChIKey of Raclopride is WAOQONBSWFLFPE-VIFPVBQESA-N.
What is the Canonical SMILES representation of Raclopride?
The Canonical SMILES representation of Raclopride is CCN1CCCC1CNC(=O)C2=C(C(=CC(=C2OC)Cl)Cl)O.
What is the CAS number for Raclopride?
The CAS number for Raclopride is 84225-95-6.
What is the XLogP3 value of Raclopride?
The XLogP3 value of Raclopride is 2.9.
What is the topological polar surface area of Raclopride?
The topological polar surface area of Raclopride is 61.8 ?2.